CAS 5891-41-8 appears in our catalog under these names: Z-Gly-Pro-Ala-OH, Z–Gly–Pro–Ala–OH. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: on request, 1g, 5g, 5000mg, 10000mg.
(2S)-2-[[(2S)-1-[2-(phenylmethoxycarbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]propanoic acid (CAS 5891-41-8) is a chemical compound with the molecular formula C18H23N3O6 and a molecular weight of 377.4 g/mol. IUPAC name: (2S)-2-[[(2S)-1-[2-(phenylmethoxycarbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]propanoic acid. InChIKey: PYRIIPBSDFLGNG-JSGCOSHPSA-N.
| Molecular formula | C18H23N3O6 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-1-[2-(phenylmethoxycarbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]propanoic acid |
| InChIKey | PYRIIPBSDFLGNG-JSGCOSHPSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)