CAS 5891-46-3 appears in our catalog under these names: H–Lys(retro–Glu–H)–OH, H-Lys(retro-Glu-H)-OH. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 500mg, 1000mg, 2000mg.
(2S)-2-amino-6-[[(2S)-2-amino-4-carboxybutanoyl]amino]hexanoic acid (CAS 5891-46-3) is a chemical compound with the molecular formula C11H21N3O5 and a molecular weight of 275.30 g/mol. IUPAC name: (2S)-2-amino-6-[[(2S)-2-amino-4-carboxybutanoyl]amino]hexanoic acid. InChIKey: DRGKVKLJFBFMED-YUMQZZPRSA-N.
| Molecular formula | C11H21N3O5 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | (2S)-2-amino-6-[[(2S)-2-amino-4-carboxybutanoyl]amino]hexanoic acid |
| InChIKey | DRGKVKLJFBFMED-YUMQZZPRSA-N |
| SMILES | C(CCNC(=O)[C@H](CCC(=O)O)N)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)