CAS 58910-96-6 is the registry number for 1,3,6,8-Tetrachloro-9H-carbazole. Offered by: TRC. Available pack sizes: 50mg.
1,3,6,8-tetrachloro-9H-carbazole (CAS 58910-96-6) is a chemical compound with the molecular formula C12H5Cl4N and a molecular weight of 305.0 g/mol. IUPAC name: 1,3,6,8-tetrachloro-9H-carbazole. InChIKey: XEUQVTHGXKXLBB-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl4N |
|---|---|
| Molecular weight | 305.0 g/mol |
| IUPAC name | 1,3,6,8-tetrachloro-9H-carbazole |
| InChIKey | XEUQVTHGXKXLBB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C3=C(N2)C(=CC(=C3)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)