Products 58911-05-0

CAS 58911-05-0 is the registry number for Methyl 1,4-dimethylcyclohex-3-ene-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 1,4-dimethylcyclohex-3-ene-1-carboxylate (CAS 58911-05-0) is a chemical compound with the molecular formula C10H16O2 and a molecular weight of 168.23 g/mol. IUPAC name: methyl 1,4-dimethylcyclohex-3-ene-1-carboxylate. InChIKey: PAXHLOIQWUFMQI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O2
Molecular weight168.23 g/mol
IUPAC namemethyl 1,4-dimethylcyclohex-3-ene-1-carboxylate
InChIKeyPAXHLOIQWUFMQI-UHFFFAOYSA-N
SMILESCC1=CCC(CC1)(C)C(=O)OC

Computed by PubChem (NCBI)