CAS 58934-46-6 appears in our catalog under these names: Lorcainide Hydrochloride, Lorcainide HCl. Offered by: TRC, GLPBio. Available pack sizes: 10mg, 1mg, 5mg.
N-(4-chlorophenyl)-2-phenyl-N-(1-propan-2-ylpiperidin-4-yl)acetamide;hydrochloride (CAS 58934-46-6) is a chemical compound with the molecular formula C22H28Cl2N2O and a molecular weight of 407.4 g/mol. IUPAC name: N-(4-chlorophenyl)-2-phenyl-N-(1-propan-2-ylpiperidin-4-yl)acetamide;hydrochloride. InChIKey: FSFSWNBDCJVFGI-UHFFFAOYSA-N.
| Molecular formula | C22H28Cl2N2O |
|---|---|
| Molecular weight | 407.4 g/mol |
| IUPAC name | N-(4-chlorophenyl)-2-phenyl-N-(1-propan-2-ylpiperidin-4-yl)acetamide;hydrochloride |
| InChIKey | FSFSWNBDCJVFGI-UHFFFAOYSA-N |
| SMILES | CC(C)N1CCC(CC1)N(C2=CC=C(C=C2)Cl)C(=O)CC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)