CAS 5894-65-5 appears in our catalog under these names: N-tert-Butylbenzamide, 95%, N-(tert-Butyl)benzamide, 95-<97%, N-(tert-Butyl)benzamide, 95+%, N–(tert–butyl)benzamide, N-tert-Butylbenzamide. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 300g, 400g, 500g, 600g, 25g, 0,25g.
N-tert-butylbenzamide (CAS 5894-65-5) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: N-tert-butylbenzamide. InChIKey: HYWWTHOGCJXTRI-UHFFFAOYSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | N-tert-butylbenzamide |
| InChIKey | HYWWTHOGCJXTRI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)