CAS 58954-23-7 appears in our catalog under these names: Olmesartan Impurity 6, 2–Propyl–1H–imidazole–4,5–dicarboxylic acid, 2-Propylimidazole-4,5-dicarboxylic acid, 2-Propyl-1H-imidazole-4,5-dicarboxylic acid 95%, 2-Propyl-1H-imidazole-4,5-dicarboxylic acid, 95%, 95%. Offered by: Chemat Brand, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 5g, 250mg, 100mg, 500mg, 1000mg, 1g, 10g.
2-propyl-1H-imidazole-4,5-dicarboxylic acid (CAS 58954-23-7) is a chemical compound with the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. IUPAC name: 2-propyl-1H-imidazole-4,5-dicarboxylic acid. InChIKey: BGPZYJSOTDBJMV-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4 |
|---|---|
| Molecular weight | 198.18 g/mol |
| IUPAC name | 2-propyl-1H-imidazole-4,5-dicarboxylic acid |
| InChIKey | BGPZYJSOTDBJMV-UHFFFAOYSA-N |
| SMILES | CCCC1=NC(=C(N1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)