CAS 5897-18-7 appears in our catalog under these names: Cyclizine dihydrochloride, 95%, Cyclizine 2HCl, Cyclizine dihydrochloride, Cyclizine (dihydrochloride), Cyclizine dihydrochloride 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10mg, 5mg, 50mg, 250mg, 25 mg, 50 mg, 5 mg, 10 mg.
1-benzhydryl-4-methylpiperazine;dihydrochloride (CAS 5897-18-7) is a chemical compound with the molecular formula C18H24Cl2N2 and a molecular weight of 339.3 g/mol. IUPAC name: 1-benzhydryl-4-methylpiperazine;dihydrochloride. InChIKey: CKLJCUGYMOMAEJ-UHFFFAOYSA-N.
| Molecular formula | C18H24Cl2N2 |
|---|---|
| Molecular weight | 339.3 g/mol |
| IUPAC name | 1-benzhydryl-4-methylpiperazine;dihydrochloride |
| InChIKey | CKLJCUGYMOMAEJ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C(C2=CC=CC=C2)C3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)