CAS 58976-65-1 is the registry number for N,N-Bis(carboxymethyl)-L-glutamic acid. Offered by: Biosynth. Available pack sizes: 1g, 0,5g, 5g.
(2S)-2-[bis(carboxymethyl)amino]pentanedioic acid (CAS 58976-65-1) is a chemical compound with the molecular formula C9H13NO8 and a molecular weight of 263.20 g/mol. IUPAC name: (2S)-2-[bis(carboxymethyl)amino]pentanedioic acid. InChIKey: VCVKIIDXVWEWSZ-YFKPBYRVSA-N.
| Molecular formula | C9H13NO8 |
|---|---|
| Molecular weight | 263.20 g/mol |
| IUPAC name | (2S)-2-[bis(carboxymethyl)amino]pentanedioic acid |
| InChIKey | VCVKIIDXVWEWSZ-YFKPBYRVSA-N |
| SMILES | C(CC(=O)O)[C@@H](C(=O)O)N(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)