CAS 5898-19-1 is the registry number for 1-(4-Bromophenyl)-2-(pyridin-2-ylthio)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(4-bromophenyl)-2-pyridin-2-ylsulfanylethanone (CAS 5898-19-1) is a chemical compound with the molecular formula C13H10BrNOS and a molecular weight of 308.20 g/mol. IUPAC name: 1-(4-bromophenyl)-2-pyridin-2-ylsulfanylethanone. InChIKey: GUGVDLUPWKIBQU-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNOS |
|---|---|
| Molecular weight | 308.20 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2-pyridin-2-ylsulfanylethanone |
| InChIKey | GUGVDLUPWKIBQU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)SCC(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)