Products 58993-79-6
CAS 58993-79-6 is the registry number for Tamsulosin Impurity 2. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(2R)-1-(4-methoxyphenyl)propan-2-amine (CAS 58993-79-6) is a chemical compound with the molecular formula C10H15NO and a molecular weight of 165.23 g/mol. IUPAC name: (2R)-1-(4-methoxyphenyl)propan-2-amine. InChIKey: NEGYEDYHPHMHGK-MRVPVSSYSA-N.
| Molecular formula | C10H15NO |
|---|---|
| Molecular weight | 165.23 g/mol |
| IUPAC name | (2R)-1-(4-methoxyphenyl)propan-2-amine |
| InChIKey | NEGYEDYHPHMHGK-MRVPVSSYSA-N |
| SMILES | C[C@H](CC1=CC=C(C=C1)OC)N |
Computed by PubChem (NCBI)
Synonyms:
L-4-methoxyamphetamine, 4-Methoxyamphetamine, (R)-, p-Methoxyamphetamine, R-(-)-, (alphaR)-4-Methoxy-alpha-methylbenzeneethanamine, (R)-1-(4-Methoxyphenyl)propan-2-amine, (2R)-1-(4-methoxyphenyl)propan-2-amine, (r)-4-methoxyamphetamine, Benzeneethanamine, 4-methoxy-alpha-methyl-, (alphaR)-, Formoterol Impurity 44, para-Methoxyamphetamine, (R)-