CAS 59-85-8 is the registry number for 4-Chloromercuribenzoic Acid. Offered by: TRC, Biosynth. Available pack sizes: 1g, 2,5g, 5g, 0,05g, 0,025g, 0,1g, 0,25g.
P-chloromercuribenzoic acid is a chlorine molecular entity and a mercuribenzoic acid. It is functionally related to a benzoic acid.
Source: ChEBI
| Molecular formula | C7H5ClHgO2 |
|---|---|
| Molecular weight | 357.16 g/mol |
| IUPAC name | (4-carboxyphenyl)-chloromercury |
| InChIKey | YFZOUMNUDGGHIW-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C(=O)O)[Hg]Cl |
Computed by PubChem (NCBI)