CAS 59-99-4 is the registry number for Neostigmine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Neostigmine is a quaternary ammonium ion comprising an anilinium ion core having three methyl substituents on the aniline nitrogen, and a 3-[(dimethylcarbamoyl)oxy] substituent at position 3. It is a parasympathomimetic which acts as a reversible acetylcholinesterase inhibitor. It has a role as an EC 3.1.1.7 (acetylcholinesterase) inhibitor and an antidote to curare poisoning.
Source: ChEBI
| Molecular formula | C12H19N2O2+ |
|---|---|
| Molecular weight | 223.29 g/mol |
| IUPAC name | [3-(dimethylcarbamoyloxy)phenyl]-trimethylazanium |
| InChIKey | ALWKGYPQUAPLQC-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)OC1=CC=CC(=C1)[N+](C)(C)C |
Computed by PubChem (NCBI)