CAS 59001-19-3 is the registry number for Diethyl ((R)-amino(phenyl)methyl)phosphonate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(R)-diethoxyphosphoryl(phenyl)methanamine;hydrochloride (CAS 59001-19-3) is a chemical compound with the molecular formula C11H19ClNO3P and a molecular weight of 279.70 g/mol. IUPAC name: (R)-diethoxyphosphoryl(phenyl)methanamine;hydrochloride. InChIKey: XMRSFMWMNXQRAP-RFVHGSKJSA-N.
| Molecular formula | C11H19ClNO3P |
|---|---|
| Molecular weight | 279.70 g/mol |
| IUPAC name | (R)-diethoxyphosphoryl(phenyl)methanamine;hydrochloride |
| InChIKey | XMRSFMWMNXQRAP-RFVHGSKJSA-N |
| SMILES | CCOP(=O)([C@H](C1=CC=CC=C1)N)OCC.Cl |
Computed by PubChem (NCBI)