CAS 59012-24-7 appears in our catalog under these names: 1-Iodobutane-d9, 1-Iodobutane-d9, 98 atom % D, min 98% Chemical Purity, 1–Iodobutane–d9. Offered by: TRC, CDN, GLPBio. Available pack sizes: 250mg, 1g.
1,1,1,2,2,3,3,4,4-nonadeuterio-4-iodobutane (CAS 59012-24-7) is a chemical compound with the molecular formula C4H9I and a molecular weight of 193.07 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4-nonadeuterio-4-iodobutane. InChIKey: KMGBZBJJOKUPIA-YNSOAAEFSA-N.
| Molecular formula | C4H9I |
|---|---|
| Molecular weight | 193.07 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4-nonadeuterio-4-iodobutane |
| InChIKey | KMGBZBJJOKUPIA-YNSOAAEFSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])I |
Computed by PubChem (NCBI)