CAS 5905-52-2 appears in our catalog under these names: Lactic acid, iron(2+) salt (2:1), 90% (T), 90% (T), Ferrous lactate hydrate, Ferrous L-lactate, 98.00%, Iron(II) lactate hydrate, >= 98.0 % dri&. Offered by: Chemat, GLPBio, Sigma-Aldrich. Available pack sizes: 25g, 2.5kg, 100g, 500g, 1kg.
Bis(2-hydroxypropanoate);iron(2+) (CAS 5905-52-2) is a chemical compound with the molecular formula C6H10FeO6 and a molecular weight of 233.98 g/mol. IUPAC name: bis(2-hydroxypropanoate);iron(2+). InChIKey: DKKCQDROTDCQOR-UHFFFAOYSA-L.
| Molecular formula | C6H10FeO6 |
|---|---|
| Molecular weight | 233.98 g/mol |
| IUPAC name | bis(2-hydroxypropanoate);iron(2+) |
| InChIKey | DKKCQDROTDCQOR-UHFFFAOYSA-L |
| SMILES | CC(C(=O)[O-])O.CC(C(=O)[O-])O.[Fe+2] |
Computed by PubChem (NCBI)