CAS 59052-83-4 is the registry number for H-Arg(Mbs)-OH. Offered by: Creative Peptides. Available pack sizes: 1g, 5g.
(2S)-2-amino-5-[[amino-[(4-methoxyphenyl)sulfonylamino]methylidene]amino]pentanoic acid (CAS 59052-83-4) is a chemical compound with the molecular formula C13H20N4O5S and a molecular weight of 344.39 g/mol. IUPAC name: (2S)-2-amino-5-[[amino-[(4-methoxyphenyl)sulfonylamino]methylidene]amino]pentanoic acid. InChIKey: DCTOTIRHYVFLFF-NSHDSACASA-N.
| Molecular formula | C13H20N4O5S |
|---|---|
| Molecular weight | 344.39 g/mol |
| IUPAC name | (2S)-2-amino-5-[[amino-[(4-methoxyphenyl)sulfonylamino]methylidene]amino]pentanoic acid |
| InChIKey | DCTOTIRHYVFLFF-NSHDSACASA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)NC(=NCCC[C@@H](C(=O)O)N)N |
Computed by PubChem (NCBI)