CAS 59077-05-3 is the registry number for Cysteine Betaine Disulphide. Offered by: TRC. Available pack sizes: 25mg.
3-[[2-carboxylato-2-(trimethylazaniumyl)ethyl]disulfanyl]-2-(trimethylazaniumyl)propanoate (CAS 59077-05-3) is a chemical compound with the molecular formula C12H24N2O4S2 and a molecular weight of 324.5 g/mol. IUPAC name: 3-[[2-carboxylato-2-(trimethylazaniumyl)ethyl]disulfanyl]-2-(trimethylazaniumyl)propanoate. InChIKey: FOGHQTAZDSIRGR-UHFFFAOYSA-N.
| Molecular formula | C12H24N2O4S2 |
|---|---|
| Molecular weight | 324.5 g/mol |
| IUPAC name | 3-[[2-carboxylato-2-(trimethylazaniumyl)ethyl]disulfanyl]-2-(trimethylazaniumyl)propanoate |
| InChIKey | FOGHQTAZDSIRGR-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)C(CSSCC(C(=O)[O-])[N+](C)(C)C)C(=O)[O-] |
Computed by PubChem (NCBI)