CAS 5908-81-6 appears in our catalog under these names: Barium tartrate, 98%, Barium tartrate, 98% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 100g, 5g, 25g, 50g, 250g.
Barium(2+);2,3-dihydroxybutanedioate (CAS 5908-81-6) is a chemical compound with the molecular formula C4H4BaO6 and a molecular weight of 285.40 g/mol. IUPAC name: barium(2+);2,3-dihydroxybutanedioate. InChIKey: HQYOWPDUMCBSLQ-UHFFFAOYSA-L.
| Molecular formula | C4H4BaO6 |
|---|---|
| Molecular weight | 285.40 g/mol |
| IUPAC name | barium(2+);2,3-dihydroxybutanedioate |
| InChIKey | HQYOWPDUMCBSLQ-UHFFFAOYSA-L |
| SMILES | C(C(C(=O)[O-])O)(C(=O)[O-])O.[Ba+2] |
Computed by PubChem (NCBI)