CAS 59085-15-3 appears in our catalog under these names: 4-(2-Carboxyethyl)-4-nitro heptanedioic acid, 97%, 4-(2-Carboxyethyl)-4-nitro heptanedioic acid 98%, Heptanedioic acid,4-(2-carboxyethyl)-4-nitro-, 98%, 98%, NITROMETHANETRISPROPIONIC ACID, 97%, NITROMETHANETRISPROPIONIC ACID, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 250mg, 10g.
4-(2-carboxyethyl)-4-nitroheptanedioic acid (CAS 59085-15-3) is a chemical compound with the molecular formula C10H15NO8 and a molecular weight of 277.23 g/mol. IUPAC name: 4-(2-carboxyethyl)-4-nitroheptanedioic acid. InChIKey: JCMYUFMDOYGRKD-UHFFFAOYSA-N.
| Molecular formula | C10H15NO8 |
|---|---|
| Molecular weight | 277.23 g/mol |
| IUPAC name | 4-(2-carboxyethyl)-4-nitroheptanedioic acid |
| InChIKey | JCMYUFMDOYGRKD-UHFFFAOYSA-N |
| SMILES | C(CC(CCC(=O)O)(CCC(=O)O)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)