CAS 5909-59-1 is the registry number for N-(3-Chloropropyl)phenothiazine. Offered by: TRC. Available pack sizes: 500mg.
10-(3-chloropropyl)phenothiazine (CAS 5909-59-1) is a chemical compound with the molecular formula C15H14ClNS and a molecular weight of 275.8 g/mol. IUPAC name: 10-(3-chloropropyl)phenothiazine. InChIKey: DLCIJMPSJTVVHJ-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNS |
|---|---|
| Molecular weight | 275.8 g/mol |
| IUPAC name | 10-(3-chloropropyl)phenothiazine |
| InChIKey | DLCIJMPSJTVVHJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C3=CC=CC=C3S2)CCCCl |
Computed by PubChem (NCBI)