CAS 591-01-5 appears in our catalog under these names: Metformin Impurity 2 (Guanylurea) Hemi-Sulfate , Guanyl Urea Sulfate, >95% (HPLC), Guanylurea sulfate, Guanylurea sulfate 100 µg/mL in Acetonitrile, N-Guanylurea Sulfate. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Mikromol, GLPBio. Available pack sizes: on request, 100g, 10g, 5g, 100mg, 1ml, 25mg, 25g.
Bis(diaminomethylideneurea);sulfuric acid (CAS 591-01-5) is a chemical compound with the molecular formula C4H14N8O6S and a molecular weight of 302.27 g/mol. IUPAC name: bis(diaminomethylideneurea);sulfuric acid. InChIKey: IATXFPUBPMZBPH-UHFFFAOYSA-N.
| Molecular formula | C4H14N8O6S |
|---|---|
| Molecular weight | 302.27 g/mol |
| IUPAC name | bis(diaminomethylideneurea);sulfuric acid |
| InChIKey | IATXFPUBPMZBPH-UHFFFAOYSA-N |
| SMILES | C(=NC(=O)N)(N)N.C(=NC(=O)N)(N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)