Products 591221-63-5
CAS 591221-63-5 is the registry number for 2-Chloro-1-(2,2-dimethyl-2h-benzo[b][1,4]thiazin-4(3h)-yl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-chloro-1-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)ethanone (CAS 591221-63-5) is a chemical compound with the molecular formula C12H14ClNOS and a molecular weight of 255.76 g/mol. IUPAC name: 2-chloro-1-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)ethanone. InChIKey: JXHDFQCVOIPATH-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNOS |
|---|---|
| Molecular weight | 255.76 g/mol |
| IUPAC name | 2-chloro-1-(2,2-dimethyl-3H-1,4-benzothiazin-4-yl)ethanone |
| InChIKey | JXHDFQCVOIPATH-UHFFFAOYSA-N |
| SMILES | CC1(CN(C2=CC=CC=C2S1)C(=O)CCl)C |
Computed by PubChem (NCBI)