CAS 59130-21-1 is the registry number for Tamoxifen analog II. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2,2-dichloro-3-phenylcyclopropyl)benzene (CAS 59130-21-1) is a chemical compound with the molecular formula C15H12Cl2 and a molecular weight of 263.2 g/mol. IUPAC name: (2,2-dichloro-3-phenylcyclopropyl)benzene. InChIKey: DJDNTZDWSNETAS-UHFFFAOYSA-N.
| Molecular formula | C15H12Cl2 |
|---|---|
| Molecular weight | 263.2 g/mol |
| IUPAC name | (2,2-dichloro-3-phenylcyclopropyl)benzene |
| InChIKey | DJDNTZDWSNETAS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2C(C2(Cl)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)