Products 59149-18-7

CAS 59149-18-7 is the registry number for 4-Benzenesulfonylamino-2-hydroxy-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.

Structural formula: {0} (CAS {1})

4-(benzenesulfonamido)-2-hydroxybenzoic acid (CAS 59149-18-7) is a chemical compound with the molecular formula C13H11NO5S and a molecular weight of 293.30 g/mol. IUPAC name: 4-(benzenesulfonamido)-2-hydroxybenzoic acid. InChIKey: NGAHQONRGRXZMN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11NO5S
Molecular weight293.30 g/mol
IUPAC name4-(benzenesulfonamido)-2-hydroxybenzoic acid
InChIKeyNGAHQONRGRXZMN-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)S(=O)(=O)NC2=CC(=C(C=C2)C(=O)O)O

Computed by PubChem (NCBI)