Products 59154-43-7
CAS 59154-43-7 appears in our catalog under these names: Lauric Acid-d23, Dodecanoic-d23 Acid, 98 atom % D, min 98% Chemical Purity, Lauric Acid–d23, LAURIC-D23 ACID, >= 98 ATOM% D, >=98% CP, Lauric acid-d23, 98.36%. Offered by: TRC, CDN, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 10mg, 1g, 0,5g, 100mg, 50mg, 500mg, 25MG, 100 mg.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosadeuteriododecanoic acid (CAS 59154-43-7) is a chemical compound with the molecular formula C12H24O2 and a molecular weight of 223.46 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosadeuteriododecanoic acid. InChIKey: POULHZVOKOAJMA-SJTGVFOPSA-N.
| Molecular formula | C12H24O2 |
|---|---|
| Molecular weight | 223.46 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosadeuteriododecanoic acid |
| InChIKey | POULHZVOKOAJMA-SJTGVFOPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)