CAS 591778-70-0 appears in our catalog under these names: CP 640186 Hydrochloride, CP-640186 hydrochloride/ 99.04% (existing batch purity), CP-640186 hydrochloride, CP-640186 HCl 98+%, (R)-Anthracen-9-yl(3-(morpholine-4-carbonyl)-[1,4'-bipiperidin]-1'-yl)methanone hydrochloride, 98+%, 98+%. Offered by: TRC, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 1g.
[(3R)-1-[1-(anthracene-9-carbonyl)piperidin-4-yl]piperidin-3-yl]-morpholin-4-ylmethanone;hydrochloride (CAS 591778-70-0) is a chemical compound with the molecular formula C30H36ClN3O3 and a molecular weight of 522.1 g/mol. IUPAC name: [(3R)-1-[1-(anthracene-9-carbonyl)piperidin-4-yl]piperidin-3-yl]-morpholin-4-ylmethanone;hydrochloride. InChIKey: DUBNXJIOBFRASV-GJFSDDNBSA-N.
| Molecular formula | C30H36ClN3O3 |
|---|---|
| Molecular weight | 522.1 g/mol |
| IUPAC name | [(3R)-1-[1-(anthracene-9-carbonyl)piperidin-4-yl]piperidin-3-yl]-morpholin-4-ylmethanone;hydrochloride |
| InChIKey | DUBNXJIOBFRASV-GJFSDDNBSA-N |
| SMILES | C1C[C@H](CN(C1)C2CCN(CC2)C(=O)C3=C4C=CC=CC4=CC5=CC=CC=C53)C(=O)N6CCOCC6.Cl |
Computed by PubChem (NCBI)