CAS 592-09-6 appears in our catalog under these names: Trichloro(3,3,3–trifluoropropyl)silane, Trichloro(3,3,3-trifluoropropyl)silane, >98.0%(GC)(T), TRICHLORO(3,3,3-TRIFLUOROPROPYL)SILANE,&. Offered by: GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 25g, 25ML.
Trichloro(3,3,3-trifluoropropyl)silane (CAS 592-09-6) is a chemical compound with the molecular formula C3H4Cl3F3Si and a molecular weight of 231.50 g/mol. IUPAC name: trichloro(3,3,3-trifluoropropyl)silane. InChIKey: WEUBQNJHVBMUMD-UHFFFAOYSA-N.
| Molecular formula | C3H4Cl3F3Si |
|---|---|
| Molecular weight | 231.50 g/mol |
| IUPAC name | trichloro(3,3,3-trifluoropropyl)silane |
| InChIKey | WEUBQNJHVBMUMD-UHFFFAOYSA-N |
| SMILES | C(C[Si](Cl)(Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)