CAS 59212-10-1 is the registry number for 2-Amino-6-bromomethyl-4(1H)-pteridinone Hydrobromide, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g.
2-amino-6-(bromomethyl)-3H-pteridin-4-one;hydrobromide (CAS 59212-10-1) is a chemical compound with the molecular formula C7H7Br2N5O and a molecular weight of 336.97 g/mol. IUPAC name: 2-amino-6-(bromomethyl)-3H-pteridin-4-one;hydrobromide. InChIKey: BGELRNOEUFVLPF-UHFFFAOYSA-N.
| Molecular formula | C7H7Br2N5O |
|---|---|
| Molecular weight | 336.97 g/mol |
| IUPAC name | 2-amino-6-(bromomethyl)-3H-pteridin-4-one;hydrobromide |
| InChIKey | BGELRNOEUFVLPF-UHFFFAOYSA-N |
| SMILES | C1=C(N=C2C(=O)NC(=NC2=N1)N)CBr.Br |
Computed by PubChem (NCBI)