CAS 59252-47-0 is the registry number for Gastrodin Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
[4-[(2S,3R,4S,5R,6R)-2,3,4,5-tetraacetyloxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl acetate (CAS 59252-47-0) is a chemical compound with the molecular formula C23H28O12 and a molecular weight of 496.5 g/mol. IUPAC name: [4-[(2S,3R,4S,5R,6R)-2,3,4,5-tetraacetyloxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl acetate. InChIKey: ZFAXRAALWQSKDW-XNBWIAOKSA-N.
| Molecular formula | C23H28O12 |
|---|---|
| Molecular weight | 496.5 g/mol |
| IUPAC name | [4-[(2S,3R,4S,5R,6R)-2,3,4,5-tetraacetyloxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl acetate |
| InChIKey | ZFAXRAALWQSKDW-XNBWIAOKSA-N |
| SMILES | CC(=O)OCC1=CC=C(C=C1)[C@@]2([C@@H]([C@H]([C@@H]([C@H](O2)CO)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)