CAS 5926-35-2 appears in our catalog under these names: Bis(trimethylsilyl)chloromethane, 95%, BIS(TRIMETHYLSILYL)CHLOROMETHANE, 97%, Bis(trimethylsilyl) methyl chloride. Offered by: Combi-blocks, Sigma-Aldrich, Fluorochem. Available pack sizes: 5g, 25g, 1g.
[chloro(trimethylsilyl)methyl]-trimethylsilane (CAS 5926-35-2) is a chemical compound with the molecular formula C7H19ClSi2 and a molecular weight of 194.85 g/mol. IUPAC name: [chloro(trimethylsilyl)methyl]-trimethylsilane. InChIKey: XNJGZHVYPBNLEB-UHFFFAOYSA-N.
| Molecular formula | C7H19ClSi2 |
|---|---|
| Molecular weight | 194.85 g/mol |
| IUPAC name | [chloro(trimethylsilyl)methyl]-trimethylsilane |
| InChIKey | XNJGZHVYPBNLEB-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C([Si](C)(C)C)Cl |
Computed by PubChem (NCBI)