CAS 5926-79-4 is the registry number for Bis(acetoxydimethyltin)oxide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
[[acetyloxy(dimethyl)stannyl]oxy-dimethylstannyl] acetate (CAS 5926-79-4) is a chemical compound with the molecular formula C8H18O5Sn2 and a molecular weight of 431.65 g/mol. IUPAC name: [[acetyloxy(dimethyl)stannyl]oxy-dimethylstannyl] acetate. InChIKey: VNRQFTQKKOQJIA-UHFFFAOYSA-L.
| Molecular formula | C8H18O5Sn2 |
|---|---|
| Molecular weight | 431.65 g/mol |
| IUPAC name | [[acetyloxy(dimethyl)stannyl]oxy-dimethylstannyl] acetate |
| InChIKey | VNRQFTQKKOQJIA-UHFFFAOYSA-L |
| SMILES | CC(=O)O[Sn](C)(C)O[Sn](C)(C)OC(=O)C |
Computed by PubChem (NCBI)