Products 5927-65-1

CAS 5927-65-1 is the registry number for 7H-Perfluoroheptanoyl fluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoyl fluoride (CAS 5927-65-1) is a chemical compound with the molecular formula C7HF13O and a molecular weight of 348.06 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoyl fluoride. InChIKey: ZEZLMEWVHJPIDP-UHFFFAOYSA-N.

Identity
Molecular formulaC7HF13O
Molecular weight348.06 g/mol
IUPAC name2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoyl fluoride
InChIKeyZEZLMEWVHJPIDP-UHFFFAOYSA-N
SMILESC(C(C(C(C(C(C(=O)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F

Computed by PubChem (NCBI)