CAS 59286-26-9 is the registry number for (2R,3R)-3-Hydroxynorleucine. Offered by: TRC. Available pack sizes: 100mg, 1g, 250mg.
(2R,3R)-2-amino-3-hydroxyhexanoic acid (CAS 59286-26-9) is a chemical compound with the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. IUPAC name: (2R,3R)-2-amino-3-hydroxyhexanoic acid. InChIKey: ONTYPWROJNTIRE-RFZPGFLSSA-N.
| Molecular formula | C6H13NO3 |
|---|---|
| Molecular weight | 147.17 g/mol |
| IUPAC name | (2R,3R)-2-amino-3-hydroxyhexanoic acid |
| InChIKey | ONTYPWROJNTIRE-RFZPGFLSSA-N |
| SMILES | CCC[C@H]([C@H](C(=O)O)N)O |
Computed by PubChem (NCBI)