CAS 59291-64-4 appears in our catalog under these names: 2,2',3,4,4',6'-Hexachlorobiphenyl, PCB 140, ROTI®Star, 5 mg, glass. Offered by: Biosynth, Roth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
1,2,3-trichloro-4-(2,4,6-trichlorophenyl)benzene (CAS 59291-64-4) is a chemical compound with the molecular formula C12H4Cl6 and a molecular weight of 360.9 g/mol. IUPAC name: 1,2,3-trichloro-4-(2,4,6-trichlorophenyl)benzene. InChIKey: XBBRGUHRZBZMPP-UHFFFAOYSA-N.
| Molecular formula | C12H4Cl6 |
|---|---|
| Molecular weight | 360.9 g/mol |
| IUPAC name | 1,2,3-trichloro-4-(2,4,6-trichlorophenyl)benzene |
| InChIKey | XBBRGUHRZBZMPP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C2=C(C=C(C=C2Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)