CAS 59311-29-4 is the registry number for 4–(2–(Benzo(d)(1,3)dioxol–5–yl)–1,3–dithian–2–yl)dihydrofuran–2(3H)–one. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
4-[2-(1,3-benzodioxol-5-yl)-1,3-dithian-2-yl]oxolan-2-one (CAS 59311-29-4) is a chemical compound with the molecular formula C15H16O4S2 and a molecular weight of 324.4 g/mol. IUPAC name: 4-[2-(1,3-benzodioxol-5-yl)-1,3-dithian-2-yl]oxolan-2-one. InChIKey: OWUSQWFRFADSFN-UHFFFAOYSA-N.
| Molecular formula | C15H16O4S2 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 4-[2-(1,3-benzodioxol-5-yl)-1,3-dithian-2-yl]oxolan-2-one |
| InChIKey | OWUSQWFRFADSFN-UHFFFAOYSA-N |
| SMILES | C1CSC(SC1)(C2CC(=O)OC2)C3=CC4=C(C=C3)OCO4 |
Computed by PubChem (NCBI)