CAS 5936-83-4 appears in our catalog under these names: Potassium 2-(allylamino)thiazole-4-carboxylate, 97%, Potassium 2-(allylamino)-1,3-thiazole-4-carboxylate, 95%, Potassium 2-(allylamino)-1,3-thiazole-4-carboxylate, 95%, 95%, Potassium 2-[(prop-2-en-1-yl)amino]-1,3-thiazole-4-carboxylate, 95%. Offered by: AmBeed, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g, 10g.
Potassium 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate (CAS 5936-83-4) is a chemical compound with the molecular formula C7H7KN2O2S and a molecular weight of 222.31 g/mol. IUPAC name: potassium 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate. InChIKey: VQVDRIZHZMCKCT-UHFFFAOYSA-M.
| Molecular formula | C7H7KN2O2S |
|---|---|
| Molecular weight | 222.31 g/mol |
| IUPAC name | potassium 2-(prop-2-enylamino)-1,3-thiazole-4-carboxylate |
| InChIKey | VQVDRIZHZMCKCT-UHFFFAOYSA-M |
| SMILES | C=CCNC1=NC(=CS1)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)