Products 59382-40-0
CAS 59382-40-0 is the registry number for Cyclopropyl[4-fluoro-3-(trifluoromethyl)phenyl]methanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Cyclopropyl-[4-fluoro-3-(trifluoromethyl)phenyl]methanone (CAS 59382-40-0) is a chemical compound with the molecular formula C11H8F4O and a molecular weight of 232.17 g/mol. IUPAC name: cyclopropyl-[4-fluoro-3-(trifluoromethyl)phenyl]methanone. InChIKey: IYHQBPJIZSYXKD-UHFFFAOYSA-N.
| Molecular formula | C11H8F4O |
|---|---|
| Molecular weight | 232.17 g/mol |
| IUPAC name | cyclopropyl-[4-fluoro-3-(trifluoromethyl)phenyl]methanone |
| InChIKey | IYHQBPJIZSYXKD-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=CC(=C(C=C2)F)C(F)(F)F |
Computed by PubChem (NCBI)