CAS 59387-91-6 appears in our catalog under these names: 2-Fluoro-1,3-dimethylpyridin-1-ium 4-methylbenzenesulfonate, 98%, 1,3-Dimethyl-2-fluoropyridiniumtoluene-4-sulfonate, 98%. Offered by: Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g.
2-fluoro-1,3-dimethylpyridin-1-ium;4-methylbenzenesulfonate (CAS 59387-91-6) is a chemical compound with the molecular formula C14H16FNO3S and a molecular weight of 297.35 g/mol. IUPAC name: 2-fluoro-1,3-dimethylpyridin-1-ium;4-methylbenzenesulfonate. InChIKey: HXUOPSAHPZTNGS-UHFFFAOYSA-M.
| Molecular formula | C14H16FNO3S |
|---|---|
| Molecular weight | 297.35 g/mol |
| IUPAC name | 2-fluoro-1,3-dimethylpyridin-1-ium;4-methylbenzenesulfonate |
| InChIKey | HXUOPSAHPZTNGS-UHFFFAOYSA-M |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].CC1=C([N+](=CC=C1)C)F |
Computed by PubChem (NCBI)