CAS 59388-58-8 appears in our catalog under these names: 1,2,3,4-Tetrahydro-2,2,4,7-tetramethylquinoline, 97%, 2,2,4,7-Tetramethyl-1,2,3,4-tetrahydroquinoline, 95+%, 1,2,3,4-Tetrahydro-2,2,4,7-tetramethylquinoline, 97% , 1,2,3,4-Tetrahydro-2,2,4,7-tetramethylquinoline, 2,2,4,7-Tetramethyl-1,2,3,4-tetrahydroquinoline, 95.0%, 95.0%. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Biosynth, Chemat. Available pack sizes: 25g, 1g, 5g, 5ml, 25ml, 2,5g, 0,25g, 10g.
2,2,4,7-tetramethyl-3,4-dihydro-1H-quinoline (CAS 59388-58-8) is a chemical compound with the molecular formula C13H19N and a molecular weight of 189.30 g/mol. IUPAC name: 2,2,4,7-tetramethyl-3,4-dihydro-1H-quinoline. InChIKey: NRWNXIXJZMSDAU-UHFFFAOYSA-N.
| Molecular formula | C13H19N |
|---|---|
| Molecular weight | 189.30 g/mol |
| IUPAC name | 2,2,4,7-tetramethyl-3,4-dihydro-1H-quinoline |
| InChIKey | NRWNXIXJZMSDAU-UHFFFAOYSA-N |
| SMILES | CC1CC(NC2=C1C=CC(=C2)C)(C)C |
Computed by PubChem (NCBI)