CAS 594-31-0 appears in our catalog under these names: Triphenylantimony dichloride, 95%, Triphenylantimony(V) dichloride, Triphenylantimony(V) dichloride, 99% , Triphenylantimony Dichloride, >98.0%(T)(qNMR), TRIPHENYLANTIMONY DICHLORIDE, 99%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Sigma-Aldrich. Available pack sizes: 1g, 5g, 25g.
Dichloro(triphenyl)-lambda5-stibane (CAS 594-31-0) is a chemical compound with the molecular formula C18H15Cl2Sb and a molecular weight of 424.0 g/mol. IUPAC name: dichloro(triphenyl)-lambda5-stibane. InChIKey: PDGPVQHGCLPCES-UHFFFAOYSA-L.
| Molecular formula | C18H15Cl2Sb |
|---|---|
| Molecular weight | 424.0 g/mol |
| IUPAC name | dichloro(triphenyl)-lambda5-stibane |
| InChIKey | PDGPVQHGCLPCES-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)[Sb](C2=CC=CC=C2)(C3=CC=CC=C3)(Cl)Cl |
Computed by PubChem (NCBI)