CAS 5943-11-3 appears in our catalog under these names: 2,8-Diiododibenzofuran, 95%, 2,8-Diiododibenzo(b,d)furan, 98%, 2,8-Diiododibenzofuran, >98.0%(GC), 2,8-Diiododibenzofuran, 97%, 97%. Offered by: Combi-blocks, AmBeed, TCI, Chemat. Available pack sizes: 1g, 200mg, 250mg, 100mg.
2,8-diiododibenzofuran (CAS 5943-11-3) is a chemical compound with the molecular formula C12H6I2O and a molecular weight of 419.98 g/mol. IUPAC name: 2,8-diiododibenzofuran. InChIKey: VKTLGHDNPWVFSY-UHFFFAOYSA-N.
| Molecular formula | C12H6I2O |
|---|---|
| Molecular weight | 419.98 g/mol |
| IUPAC name | 2,8-diiododibenzofuran |
| InChIKey | VKTLGHDNPWVFSY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1I)C3=C(O2)C=CC(=C3)I |
Computed by PubChem (NCBI)