Products 59453-24-6
CAS 59453-24-6 appears in our catalog under these names: Bromperidol hydrochloride, Bromperidol hydrochloride, Bromperidol (hydrochloride), 99.96%, Bromperidol (hydrochloride), 99%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 2mg, 10mg, 100mg, 25mg, 5mg, 50mg, 25 mg, 50 mg.
4-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one;hydrochloride (CAS 59453-24-6) is a chemical compound with the molecular formula C21H24BrClFNO2 and a molecular weight of 456.8 g/mol. IUPAC name: 4-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one;hydrochloride. InChIKey: XAYXCUZHMISKSM-UHFFFAOYSA-N.
| Molecular formula | C21H24BrClFNO2 |
|---|---|
| Molecular weight | 456.8 g/mol |
| IUPAC name | 4-[4-(4-bromophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one;hydrochloride |
| InChIKey | XAYXCUZHMISKSM-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1(C2=CC=C(C=C2)Br)O)CCCC(=O)C3=CC=C(C=C3)F.Cl |
Computed by PubChem (NCBI)