CAS 59467-94-6 appears in our catalog under these names: Midazolam Maleate, >95% (HPLC), Midazolam Maleate, (13C6)-Midazolam maleate salt. Offered by: TRC, Mikromol, Biosynth, Chemat Brand. Available pack sizes: 100mg, 1g, 500mg, 250mg, 50mg, 1000mg, on request.
(Z)-but-2-enedioic acid;8-chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine (CAS 59467-94-6) is a chemical compound with the molecular formula C22H17ClFN3O4 and a molecular weight of 441.8 g/mol. IUPAC name: (Z)-but-2-enedioic acid;8-chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine. InChIKey: XYGVIBXOJOOCFR-BTJKTKAUSA-N.
| Molecular formula | C22H17ClFN3O4 |
|---|---|
| Molecular weight | 441.8 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;8-chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine |
| InChIKey | XYGVIBXOJOOCFR-BTJKTKAUSA-N |
| SMILES | CC1=NC=C2N1C3=C(C=C(C=C3)Cl)C(=NC2)C4=CC=CC=C4F.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)