CAS 59468-07-4 appears in our catalog under these names: Midazolam EP Impurity A, Midazolam Impurity 1(Midazolam EP Impurity A), 5,6-Dihydro Midazolam, >95% (HPLC), 5,6-Dihydro Midazolam (1mg/ml in Acetonitrile), (6RS)-8-Chloro-6-(2-fluorophenyl)-1-methyl-5,6-dihydro-4H-imidazo(1,5-a)(1,4)benzodiazepine. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 10x1ml.
8-chloro-6-(2-fluorophenyl)-1-methyl-5,6-dihydro-4H-imidazo[1,5-a][1,4]benzodiazepine (CAS 59468-07-4) is a chemical compound with the molecular formula C18H15ClFN3 and a molecular weight of 327.8 g/mol. IUPAC name: 8-chloro-6-(2-fluorophenyl)-1-methyl-5,6-dihydro-4H-imidazo[1,5-a][1,4]benzodiazepine. InChIKey: HMQYFIKOHHSETE-UHFFFAOYSA-N.
| Molecular formula | C18H15ClFN3 |
|---|---|
| Molecular weight | 327.8 g/mol |
| IUPAC name | 8-chloro-6-(2-fluorophenyl)-1-methyl-5,6-dihydro-4H-imidazo[1,5-a][1,4]benzodiazepine |
| InChIKey | HMQYFIKOHHSETE-UHFFFAOYSA-N |
| SMILES | CC1=NC=C2N1C3=C(C=C(C=C3)Cl)C(NC2)C4=CC=CC=C4F |
Computed by PubChem (NCBI)