Products 59474-17-8

CAS 59474-17-8 is the registry number for 2-Methoxy-5,5-Dimethyl-1,2-Oxaphosphol-3-Ene-2-Oxide. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-methoxy-5,5-dimethyl-1,2lambda5-oxaphosphole 2-oxide (CAS 59474-17-8) is a chemical compound with the molecular formula C6H11O3P and a molecular weight of 162.12 g/mol. IUPAC name: 2-methoxy-5,5-dimethyl-1,2lambda5-oxaphosphole 2-oxide. InChIKey: WCLCRIBZAAHEMD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11O3P
Molecular weight162.12 g/mol
IUPAC name2-methoxy-5,5-dimethyl-1,2lambda5-oxaphosphole 2-oxide
InChIKeyWCLCRIBZAAHEMD-UHFFFAOYSA-N
SMILESCC1(C=CP(=O)(O1)OC)C

Computed by PubChem (NCBI)