CAS 5948-04-9 is the registry number for rel-(2R,5R)-2-Methyl-5-(prop-1-en-2-yl)cyclohexan-1-one 95% mix TBC as stabilizer. Offered by: Ambeed. Available pack sizes: 5g, 25g, 100g, 500g, 1000g.
(+)-dihydrocarvone is a dihydrocarvone in (R,R) configuration. It is an enantiomer of a (-)-dihydrocarvone.
Source: ChEBI
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 152.23 g/mol |
| IUPAC name | trans-(2R,5R)-2-methyl-5-prop-1-en-2-ylcyclohexan-1-one |
| InChIKey | AZOCECCLWFDTAP-RKDXNWHRSA-N |
| SMILES | C[C@@H]1CC[C@H](CC1=O)C(=C)C |
Computed by PubChem (NCBI)