Products 59483-54-4
CAS 59483-54-4 appears in our catalog under these names: 3–Chloro–2–nitroaniline, 3-Chloro-2-nitroaniline, 3-Chloro-2-nitroaniline 98%, 3-Chloro-2-nitroaniline, 98%, 98%, 3-Chloro-2-nitroaniline, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 25g, 5g, 50g, 250g, 1g, 500g.
3-chloro-2-nitroaniline (CAS 59483-54-4) is a chemical compound with the molecular formula C6H5ClN2O2 and a molecular weight of 172.57 g/mol. IUPAC name: 3-chloro-2-nitroaniline. InChIKey: YADOEPHJIBKBCN-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O2 |
|---|---|
| Molecular weight | 172.57 g/mol |
| IUPAC name | 3-chloro-2-nitroaniline |
| InChIKey | YADOEPHJIBKBCN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)[N+](=O)[O-])N |
Computed by PubChem (NCBI)