CAS 595-90-4 appears in our catalog under these names: Tetraphenyltin, 98%, Tetraphenyltin, Tetraphenyltin, >98.0%(W), TETRAPHENYLTIN, 97%, Tetraphenyltin, Concentration: 100 µg/ml Solvent: tert-Butyl methyl ether. Offered by: Combi-blocks, Dr. Ehrenstorfer, TCI, Sigma-Aldrich, HPC Standards. Available pack sizes: 1g, 100g, 25g, 5g, 100mg, 1x100mg, 1x5ml.
Tetraphenylstannane (CAS 595-90-4) is a chemical compound with the molecular formula C24H20Sn and a molecular weight of 427.1 g/mol. IUPAC name: tetraphenylstannane. InChIKey: CRHIAMBJMSSNNM-UHFFFAOYSA-N.
| Molecular formula | C24H20Sn |
|---|---|
| Molecular weight | 427.1 g/mol |
| IUPAC name | tetraphenylstannane |
| InChIKey | CRHIAMBJMSSNNM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Sn](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)