Products 5955-74-8
CAS 5955-74-8 is the registry number for 3-Methylbenzoyl cyanide, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg.
3-methylbenzoyl cyanide (CAS 5955-74-8) is a chemical compound with the molecular formula C9H7NO and a molecular weight of 145.16 g/mol. IUPAC name: 3-methylbenzoyl cyanide. InChIKey: JEOHRIFJRDJKGQ-UHFFFAOYSA-N.
| Molecular formula | C9H7NO |
|---|---|
| Molecular weight | 145.16 g/mol |
| IUPAC name | 3-methylbenzoyl cyanide |
| InChIKey | JEOHRIFJRDJKGQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)C#N |
Computed by PubChem (NCBI)
Synonyms:
3-methylbenzoyl cyanide, Oxo-m-tolyl-acetonitrile, m-Toluoyl cyanide, 3-Methylbenzoylcyanide, (3-methylphenyl)(oxo)acetonitrile, JEOHRIFJRDJKGQ-UHFFFAOYSA-N, 3-Methylbenzene-1-carbonyl cyanide, benzeneacetonitrile, 3-methyl-alpha-oxo-, Gemisch 3-Methyl benzoyl chloride + 3-Methylbenzoyl cyanide, InChI=1/C9H7NO/c1-7-3-2-4-8(5-7)9(11)6-10/h2-5H,1H